cas: 75383-61-8 — see every product listed under this CAS number, including other names
BENZYL (3-HYDROXYBENZYL)CARBAMATE (CAS 75383-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530098-100MG |
| cas | 75383-61-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 5g | 1575.50 Pln | |
| Fluorochem | 10g | 2700.11 Pln | |
| Fluorochem | 25g | 5006.59 Pln |
| delivery time | 3-4 weeks |
|---|
Benzyl N-[(3-hydroxyphenyl)methyl]carbamate (CAS 75383-61-8) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: benzyl N-[(3-hydroxyphenyl)methyl]carbamate. InChIKey: LQSKRMJMDBYZAY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | benzyl N-[(3-hydroxyphenyl)methyl]carbamate |
| InChIKey | LQSKRMJMDBYZAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)