cas: 75383-61-8 — see every product listed under this CAS number, including other names
Benzyl (3-hydroxybenzyl)carbamate 95+% (CAS 75383-61-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A415480-250mg |
| cas | 75383-61-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1254.81 Pln | |
| Ambeed | 10g | 2139.25 Pln | |
| Ambeed | 25g | 4208.50 Pln | |
| Ambeed | 100g | 13308.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A415480 |
Benzyl N-[(3-hydroxyphenyl)methyl]carbamate (CAS 75383-61-8) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: benzyl N-[(3-hydroxyphenyl)methyl]carbamate. InChIKey: LQSKRMJMDBYZAY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | benzyl N-[(3-hydroxyphenyl)methyl]carbamate |
| InChIKey | LQSKRMJMDBYZAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)