cas: 455267-26-2 — see every product listed under this CAS number, including other names
BENZYL 3-CARBAMOYLPYRROLIDINE-1-CARBOXYLATE, 95%, 95% (CAS 455267-26-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9IT-1g |
| cas | 455267-26-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2162.00 Pln | |
| Chemat | 10g | 3837.20 Pln | |
| Chemat | 25g | 6366.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-carbamoylpyrrolidine-1-carboxylate (CAS 455267-26-2) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl 3-carbamoylpyrrolidine-1-carboxylate. InChIKey: RFMDNYSGEQPCAA-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl 3-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | RFMDNYSGEQPCAA-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)