cas: 34582-32-6 — see every product listed under this CAS number, including other names
BOC-ASP(OTBU), 97% (CAS 34582-32-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047784-1G |
| cas | 34582-32-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 659.16 Pln | |
| Fluorochem | 500g | 3033.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 34582-32-6) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: RAUQRYTYJIYLTF-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | RAUQRYTYJIYLTF-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)