cas: 588-68-1 — see every product listed under this CAS number, including other names
Benzalazine, 99% (CAS 588-68-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690853-25G |
| cas | 588-68-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 404.04 Pln | |
| Fluorochem | 100g | 1346.42 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
N-(benzylideneamino)-1-phenylmethanimine (CAS 588-68-1) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: N-(benzylideneamino)-1-phenylmethanimine. InChIKey: CWLGEPSKQDNHIO-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-(benzylideneamino)-1-phenylmethanimine |
| InChIKey | CWLGEPSKQDNHIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NN=CC2=CC=CC=C2 |
Computed by PubChem (NCBI)