cas: 66896-64-8 — see every product listed under this CAS number, including other names
Benzamide, 2,4-dichloro-N-methyl-, 98%, 98% (CAS 66896-64-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBNF-10mg |
| cas | 66896-64-8 |
| size | 10mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 347.60 Pln | |
| Chemat | 25mg | 549.20 Pln | |
| Chemat | 100mg | 866.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-N-methylbenzamide (CAS 66896-64-8) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 2,4-dichloro-N-methylbenzamide. InChIKey: LHGOQNXBLLXSIZ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2,4-dichloro-N-methylbenzamide |
| InChIKey | LHGOQNXBLLXSIZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)