cas: 771579-78-3 — see every product listed under this CAS number, including other names
Benzenemethanamine, 2-amino-3-bromo-5-nitro- (CAS 771579-78-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTGZ-1g |
| cas | 771579-78-3 |
| size | 1g |
| availability | 20.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 11958.80 Pln |
| delivery time | 3 weeks |
|---|
2-(aminomethyl)-6-bromo-4-nitroaniline (CAS 771579-78-3) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 2-(aminomethyl)-6-bromo-4-nitroaniline. InChIKey: NILKDFOQJZBCKG-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-(aminomethyl)-6-bromo-4-nitroaniline |
| InChIKey | NILKDFOQJZBCKG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)