Benzo[b]thiophene-2-carboxylic acid, 5-methoxy-, methyl ester, 95%, 95%
cas: 19492-99-0 — see every product listed under this CAS number, including other names
Benzo[b]thiophene-2-carboxylic acid, 5-methoxy-, methyl ester, 95%, 95% (CAS 19492-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118REU-100mg |
| cas | 19492-99-0 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1062.80 Pln | |
| Chemat | 10g | 1802.00 Pln | |
| Chemat | 25g | 3539.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-methoxy-1-benzothiophene-2-carboxylate (CAS 19492-99-0) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: methyl 5-methoxy-1-benzothiophene-2-carboxylate. InChIKey: NYPCNZRDJYLVLF-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl 5-methoxy-1-benzothiophene-2-carboxylate |
| InChIKey | NYPCNZRDJYLVLF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
methyl 5-methoxybenzo[b]thiophene-2-carboxylate, 5-Methoxy-benzo[b]thiophene-2-carboxylic acid methyl ester, Benzo[b]thiophene-2-carboxylic acid, 5-methoxy-, methyl ester, Methyl 5-Methoxybenzothiophene-2-carboxylate, Methyl5-methoxybenzo[b]thiophene-2-carboxylate, NYPCNZRDJYLVLF-UHFFFAOYSA-N