cas: 19492-99-0 — see every product listed under this CAS number, including other names
Methyl 5-methoxybenzo[b]thiophene-2-carboxylate 95% (CAS 19492-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A684161-100mg |
| cas | 19492-99-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1443.94 Pln | |
| Ambeed | 10g | 2456.31 Pln | |
| Ambeed | 25g | 5321.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A684161 |
Methyl 5-methoxy-1-benzothiophene-2-carboxylate (CAS 19492-99-0) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: methyl 5-methoxy-1-benzothiophene-2-carboxylate. InChIKey: NYPCNZRDJYLVLF-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl 5-methoxy-1-benzothiophene-2-carboxylate |
| InChIKey | NYPCNZRDJYLVLF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=C2)C(=O)OC |
Computed by PubChem (NCBI)