Benzo[c]isoxazole-3-carboxylic acid 95%
cas: 642-91-1 — see every product listed under this CAS number, including other names
Benzo[c]isoxazole-3-carboxylic acid 95% (CAS 642-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A726081-100mg |
| cas | 642-91-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 2295.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A726081 |
2,1-benzoxazole-3-carboxylic acid (CAS 642-91-1) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 2,1-benzoxazole-3-carboxylic acid. InChIKey: PHYDLUSJJFZNFG-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2,1-benzoxazole-3-carboxylic acid |
| InChIKey | PHYDLUSJJFZNFG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(ON=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)