Benzofuran-3-carboxylic acid, 95%
cas: 26537-68-8 — see every product listed under this CAS number, including other names
Benzofuran-3-carboxylic acid, 95% (CAS 26537-68-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216652-250MG |
| cas | 26537-68-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 500mg | 346.77 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 1518.23 Pln | |
| Fluorochem | 10g | 2976.05 Pln | |
| Fluorochem | 25g | 5824.01 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-benzofuran-3-carboxylic acid (CAS 26537-68-8) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 1-benzofuran-3-carboxylic acid. InChIKey: BENJFDPHDCGUAQ-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 1-benzofuran-3-carboxylic acid |
| InChIKey | BENJFDPHDCGUAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CO2)C(=O)O |
Computed by PubChem (NCBI)