Products 90484-22-3
CAS 90484-22-3 appears in our catalog under these names: Benzofuran–7–carboxylic acid, Benzo[b]furan-7-carboxylic acid, 97% , Benzofuran-7-carboxylic acid, 95%, 95%, Benzofuran-7-carboxylic acid, 97%. Offered by: GLPBio, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
1-benzofuran-7-carboxylic acid (CAS 90484-22-3) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 1-benzofuran-7-carboxylic acid. InChIKey: QMHILIQFOBNARN-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 1-benzofuran-7-carboxylic acid |
| InChIKey | QMHILIQFOBNARN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)OC=C2 |
Computed by PubChem (NCBI)