cas: 85-58-5 — see every product listed under this CAS number, including other names
Benzophenone-2,4'-dicarboxylic Acid Monohydrate (CAS 85-58-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115UEU-250mg |
| cas | 85-58-5 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 25g | 683.60 Pln |
| delivery time | 3 weeks |
|---|
2-(4-carboxybenzoyl)benzoic acid (CAS 85-58-5) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 2-(4-carboxybenzoyl)benzoic acid. InChIKey: RWHRIIMYBNGFEV-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 2-(4-carboxybenzoyl)benzoic acid |
| InChIKey | RWHRIIMYBNGFEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)