cas: 134996-50-2 — see every product listed under this CAS number, including other names
Benzothiophene sulfone-2-methanol (CAS 134996-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GCZ-100mg |
| cas | 134996-50-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 500mg | 328.40 Pln |
| delivery time | 3 weeks |
|---|
(1,1-dioxo-1-benzothiophen-2-yl)methanol (CAS 134996-50-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: (1,1-dioxo-1-benzothiophen-2-yl)methanol. InChIKey: GMPSGLSPNPTTHT-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | (1,1-dioxo-1-benzothiophen-2-yl)methanol |
| InChIKey | GMPSGLSPNPTTHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2(=O)=O)CO |
Computed by PubChem (NCBI)