cas: 1187386-06-6 — see every product listed under this CAS number, including other names
Benzyl (1-(4-bromophenyl)cyclopropyl)carbamate, 98% (CAS 1187386-06-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A292665-1g |
| cas | 1187386-06-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 349.93 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 476.93 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl N-[1-(4-bromophenyl)cyclopropyl]carbamate (CAS 1187386-06-6) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: benzyl N-[1-(4-bromophenyl)cyclopropyl]carbamate. InChIKey: JEQGBWWBXOGYMZ-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO2 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | benzyl N-[1-(4-bromophenyl)cyclopropyl]carbamate |
| InChIKey | JEQGBWWBXOGYMZ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)Br)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)