CAS 625127-09-5 is the registry number for Benzyl 7-bromo-3,4-dihydroisoquinoline-2(1h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl 7-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 625127-09-5) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: benzyl 7-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: RRSOZVJLXHQQSF-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO2 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | benzyl 7-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | RRSOZVJLXHQQSF-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C=CC(=C2)Br)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)