CAS 1881295-82-4 is the registry number for Benzyl 6-bromo-3,4-dihydro-2H-quinoline-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Benzyl 6-bromo-3,4-dihydro-2H-quinoline-1-carboxylate (CAS 1881295-82-4) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: benzyl 6-bromo-3,4-dihydro-2H-quinoline-1-carboxylate. InChIKey: OLINVFQAMKMSPQ-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO2 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | benzyl 6-bromo-3,4-dihydro-2H-quinoline-1-carboxylate |
| InChIKey | OLINVFQAMKMSPQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)N(C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)