Products 2768036-38-8
CAS 2768036-38-8 is the registry number for Ethyl 3-bromo-4,9-dihydro-2H-4,9-ethanobenzo[f]isoindole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 12-bromo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10-carboxylate (CAS 2768036-38-8) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: ethyl 12-bromo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10-carboxylate. InChIKey: PWBQGQNHKUXESR-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO2 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | ethyl 12-bromo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9,12-pentaene-10-carboxylate |
| InChIKey | PWBQGQNHKUXESR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C3CCC(C2=C(N1)Br)C4=CC=CC=C34 |
Computed by PubChem (NCBI)