Products 2270909-45-8

CAS 2270909-45-8 is the registry number for 3-(5-Bromo-2,3-dihydro-indol-1-ylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 3-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate (CAS 2270909-45-8) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: methyl 3-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate. InChIKey: UHXKTEGRLFYGFN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16BrNO2
Molecular weight346.2 g/mol
IUPAC namemethyl 3-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate
InChIKeyUHXKTEGRLFYGFN-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)CN2CCC3=C2C=CC(=C3)Br

Computed by PubChem (NCBI)