Products 1482206-33-6

CAS 1482206-33-6 is the registry number for 4-(5-Bromo-2,3-dihydro-indol-1-ylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate (CAS 1482206-33-6) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate. InChIKey: XAQLPGBFDIWTJD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16BrNO2
Molecular weight346.2 g/mol
IUPAC namemethyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate
InChIKeyXAQLPGBFDIWTJD-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)CN2CCC3=C2C=CC(=C3)Br

Computed by PubChem (NCBI)