CAS 1482206-33-6 is the registry number for 4-(5-Bromo-2,3-dihydro-indol-1-ylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate (CAS 1482206-33-6) is a chemical compound with the molecular formula C17H16BrNO2 and a molecular weight of 346.2 g/mol. IUPAC name: methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate. InChIKey: XAQLPGBFDIWTJD-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO2 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate |
| InChIKey | XAQLPGBFDIWTJD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2CCC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)