cas: 916423-53-5 — see every product listed under this CAS number, including other names
Benzyl 3-cyano-4-oxopiperidine-1-carboxylate (CAS 916423-53-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048004-1G |
| cas | 916423-53-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 10g | 4137.10 Pln |
| delivery time | 2-3 weeks |
|---|
Benzyl 3-cyano-4-oxopiperidine-1-carboxylate (CAS 916423-53-5) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: benzyl 3-cyano-4-oxopiperidine-1-carboxylate. InChIKey: DRZBPQWPPJBSBG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | benzyl 3-cyano-4-oxopiperidine-1-carboxylate |
| InChIKey | DRZBPQWPPJBSBG-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)C#N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)