cas: 287953-54-2 — see every product listed under this CAS number, including other names
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate 95% (CAS 287953-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A203364-100mg |
| cas | 287953-54-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1989.06 Pln | |
| Ambeed | 10g | 3329.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A203364 |
Benzyl 4-chlorosulfonylpiperidine-1-carboxylate (CAS 287953-54-2) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: benzyl 4-chlorosulfonylpiperidine-1-carboxylate. InChIKey: HEGCWAOVTPVFBJ-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4S |
|---|---|
| Molecular weight | 317.79 g/mol |
| IUPAC name | benzyl 4-chlorosulfonylpiperidine-1-carboxylate |
| InChIKey | HEGCWAOVTPVFBJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1S(=O)(=O)Cl)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)