cas: 208588-34-5 — see every product listed under this CAS number, including other names
Benzyl 4-aminobenzoate hydrochloride, 95+% (CAS 208588-34-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A504787-1g |
| cas | 208588-34-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10056.34 Pln | |
| AmBeed | 5g | 30113.65 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 4-aminobenzoate;hydrochloride (CAS 208588-34-5) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: benzyl 4-aminobenzoate;hydrochloride. InChIKey: LGUPRLAPQNVKST-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | benzyl 4-aminobenzoate;hydrochloride |
| InChIKey | LGUPRLAPQNVKST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)