CAS 948294-10-8 appears in our catalog under these names: 5-Chloro-2,8-dimethylquinoline-3-carboxylic acid ethyl ester, 95%, Ethyl 5-chloro-2,8-dimethylquinoline-3-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 5-chloro-2,8-dimethylquinoline-3-carboxylate (CAS 948294-10-8) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: ethyl 5-chloro-2,8-dimethylquinoline-3-carboxylate. InChIKey: MLXDBZOEQRKMDW-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | ethyl 5-chloro-2,8-dimethylquinoline-3-carboxylate |
| InChIKey | MLXDBZOEQRKMDW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2N=C1C)C)Cl |
Computed by PubChem (NCBI)