Products 948289-32-5
CAS 948289-32-5 is the registry number for 6-Chloro-2,8-dimethylquinoline-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 6-chloro-2,8-dimethylquinoline-3-carboxylate (CAS 948289-32-5) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: ethyl 6-chloro-2,8-dimethylquinoline-3-carboxylate. InChIKey: RHNLYNLLYLFJSZ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | ethyl 6-chloro-2,8-dimethylquinoline-3-carboxylate |
| InChIKey | RHNLYNLLYLFJSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C(=CC(=CC2=C1)Cl)C)C |
Computed by PubChem (NCBI)