CAS 312713-96-5 is the registry number for 7-Chloro-6-methyl-3a,4,5,9b-tetrahydro-3h-cyclopenta[c]quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid (CAS 312713-96-5) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: 7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid. InChIKey: XFHJYHWLYWRLBP-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 7-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
| InChIKey | XFHJYHWLYWRLBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(C3C2C=CC3)C(=O)O)Cl |
Computed by PubChem (NCBI)