Products 1820741-08-9

CAS 1820741-08-9 is the registry number for methyl 4-(2-aminophenyl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-(2-aminophenyl)benzoate;hydrochloride (CAS 1820741-08-9) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: methyl 4-(2-aminophenyl)benzoate;hydrochloride. InChIKey: CYLZAXQTESEVQI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14ClNO2
Molecular weight263.72 g/mol
IUPAC namemethyl 4-(2-aminophenyl)benzoate;hydrochloride
InChIKeyCYLZAXQTESEVQI-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C2=CC=CC=C2N.Cl

Computed by PubChem (NCBI)