CAS 1820741-08-9 is the registry number for methyl 4-(2-aminophenyl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(2-aminophenyl)benzoate;hydrochloride (CAS 1820741-08-9) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: methyl 4-(2-aminophenyl)benzoate;hydrochloride. InChIKey: CYLZAXQTESEVQI-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | methyl 4-(2-aminophenyl)benzoate;hydrochloride |
| InChIKey | CYLZAXQTESEVQI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=CC=C2N.Cl |
Computed by PubChem (NCBI)