Products 208588-34-5
CAS 208588-34-5 appears in our catalog under these names: Benzyl 4-aminobenzoate hydrochloride, 95%, Benzyl 4-aminobenzoate hydrochloride, 95+%, benzyl4–aminobenzoate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Benzyl 4-aminobenzoate;hydrochloride (CAS 208588-34-5) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: benzyl 4-aminobenzoate;hydrochloride. InChIKey: LGUPRLAPQNVKST-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | benzyl 4-aminobenzoate;hydrochloride |
| InChIKey | LGUPRLAPQNVKST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)