cas: 105113-83-5 — see every product listed under this CAS number, including other names
Benzyl methyl maleate, 95%, 95% (CAS 105113-83-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13AKND-1g |
| cas | 105113-83-5 |
| size | 1g |
| availability | 99g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2459.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-O-benzyl 1-O-methyl (Z)-but-2-enedioate (CAS 105113-83-5) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 4-O-benzyl 1-O-methyl (Z)-but-2-enedioate. InChIKey: BMJXWTXRRZMGMV-FPLPWBNLSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 4-O-benzyl 1-O-methyl (Z)-but-2-enedioate |
| InChIKey | BMJXWTXRRZMGMV-FPLPWBNLSA-N |
| SMILES | COC(=O)/C=C\C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)