cas: 153243-86-8 — see every product listed under this CAS number, including other names
Benzyl3-aminobenzoatehcl, 97% (CAS 153243-86-8) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A996383-5g |
| cas | 153243-86-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9418.36 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 3-aminobenzoate;hydrochloride (CAS 153243-86-8) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: benzyl 3-aminobenzoate;hydrochloride. InChIKey: AJBQQOKPBCXXJC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | benzyl 3-aminobenzoate;hydrochloride |
| InChIKey | AJBQQOKPBCXXJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)