CAS 87100-28-5 appears in our catalog under these names: Benzylboronic acid pinacol ester, Benzylboronic acid pinacol ester, 96% , 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >97.0%(GC), 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, Benzylboronic acid pinacol ester, 97.0%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 250g, 1kg.
2-benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 87100-28-5) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 218.10 g/mol. IUPAC name: 2-benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YCNQPAVKQPLZRS-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 2-benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YCNQPAVKQPLZRS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)