cas: 773888-45-2 — see every product listed under this CAS number, including other names
Biotin Alkyne, >95.0%(HPLC)(T) (CAS 773888-45-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B6602-50MG |
| cas | 773888-45-2 |
| size | 50mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 50mg | 355.86 Pln | |
| TCI | 250mg | 847.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-prop-2-ynylpentanamide (CAS 773888-45-2) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-prop-2-ynylpentanamide. InChIKey: JJXUHRONZVELPY-NHCYSSNCSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-prop-2-ynylpentanamide |
| InChIKey | JJXUHRONZVELPY-NHCYSSNCSA-N |
| SMILES | C#CCNC(=O)CCCC[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2 |
Computed by PubChem (NCBI)