cas: 773888-45-2 — see every product listed under this CAS number, including other names
Biotin alkyne, 95% (CAS 773888-45-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1g, 250mg. Offered by: Lumiprobe, Combi-blocks.
| brand | Lumiprobe |
|---|---|
| catalog number | LP-x37B0-10mg |
| cas | 773888-45-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Lumiprobe | 10mg | 561.05 Pln | |
| Lumiprobe | 25mg | 869.75 Pln | |
| Lumiprobe | 50mg | 1435.70 Pln | |
| Lumiprobe | 100mg | 2104.55 Pln | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request |
| purity | 95% |
|---|---|
| delivery time | 2 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-prop-2-ynylpentanamide (CAS 773888-45-2) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-prop-2-ynylpentanamide. InChIKey: JJXUHRONZVELPY-NHCYSSNCSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-prop-2-ynylpentanamide |
| InChIKey | JJXUHRONZVELPY-NHCYSSNCSA-N |
| SMILES | C#CCNC(=O)CCCC[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2 |
Computed by PubChem (NCBI)