cas: 728918-79-4 — see every product listed under this CAS number, including other names
Biphenyl-3,3'-dicarboxylic acid 3-isopropyl ester, 95+% (CAS 728918-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A979307-1g |
| cas | 728918-79-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2836.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(3-propan-2-yloxycarbonylphenyl)benzoic acid (CAS 728918-79-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 3-(3-propan-2-yloxycarbonylphenyl)benzoic acid. InChIKey: YAKLXVIMPZGSIR-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 3-(3-propan-2-yloxycarbonylphenyl)benzoic acid |
| InChIKey | YAKLXVIMPZGSIR-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)