CAS 20837-35-8 appears in our catalog under these names: 1,5-Bis(4-hydroxyphenyl)pentane-1,5-dione, 95%, 1,5-Bis(4-hydroxyphenyl)pentane-1,5-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg.
1,5-bis(4-hydroxyphenyl)pentane-1,5-dione (CAS 20837-35-8) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 1,5-bis(4-hydroxyphenyl)pentane-1,5-dione. InChIKey: PCLZJNZZJDVGDM-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 1,5-bis(4-hydroxyphenyl)pentane-1,5-dione |
| InChIKey | PCLZJNZZJDVGDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCC(=O)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)