cas: 1755-51-7 — see every product listed under this CAS number, including other names
Bis(2,4-dimethoxyphenyl)(2-methoxyphenyl)methanol, 95% (CAS 1755-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F722412-100MG |
| cas | 1755-51-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 716.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Bis(2,4-dimethoxyphenyl)-(2-methoxyphenyl)methanol (CAS 1755-51-7) is a chemical compound with the molecular formula C24H26O6 and a molecular weight of 410.5 g/mol. IUPAC name: bis(2,4-dimethoxyphenyl)-(2-methoxyphenyl)methanol. InChIKey: GEPSNGQKRLULHW-UHFFFAOYSA-N.
| Molecular formula | C24H26O6 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | bis(2,4-dimethoxyphenyl)-(2-methoxyphenyl)methanol |
| InChIKey | GEPSNGQKRLULHW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C2=C(C=C(C=C2)OC)OC)(C3=CC=CC=C3OC)O)OC |
Computed by PubChem (NCBI)