CAS 1185047-73-7 appears in our catalog under these names: Mangostin-d3, Mangostin–d3. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
1,3,6-trihydroxy-2,8-bis(3-methylbut-2-enyl)-7-(trideuteriomethoxy)xanthen-9-one (CAS 1185047-73-7) is a chemical compound with the molecular formula C24H26O6 and a molecular weight of 413.5 g/mol. IUPAC name: 1,3,6-trihydroxy-2,8-bis(3-methylbut-2-enyl)-7-(trideuteriomethoxy)xanthen-9-one. InChIKey: GNRIZKKCNOBBMO-VPYROQPTSA-N.
| Molecular formula | C24H26O6 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 1,3,6-trihydroxy-2,8-bis(3-methylbut-2-enyl)-7-(trideuteriomethoxy)xanthen-9-one |
| InChIKey | GNRIZKKCNOBBMO-VPYROQPTSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C2=C(C=C1O)OC3=C(C2=O)C(=C(C(=C3)O)CC=C(C)C)O)CC=C(C)C |
Computed by PubChem (NCBI)