Products 96552-41-9
CAS 96552-41-9 is the registry number for Cudraxanthone D. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,8-trihydroxy-6-methoxy-5-(2-methylbut-3-en-2-yl)-1-(3-methylbut-2-enyl)xanthen-9-one (CAS 96552-41-9) is a chemical compound with the molecular formula C24H26O6 and a molecular weight of 410.5 g/mol. IUPAC name: 2,3,8-trihydroxy-6-methoxy-5-(2-methylbut-3-en-2-yl)-1-(3-methylbut-2-enyl)xanthen-9-one. InChIKey: UIIGEZZURHDEDK-UHFFFAOYSA-N.
| Molecular formula | C24H26O6 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 2,3,8-trihydroxy-6-methoxy-5-(2-methylbut-3-en-2-yl)-1-(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | UIIGEZZURHDEDK-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(O2)C(=C(C=C3O)OC)C(C)(C)C=C)O)O)C |
Computed by PubChem (NCBI)
Synonyms:
cudraxanthone D, orb1682879