Products 906794-57-8
CAS 906794-57-8 appears in our catalog under these names: Parvifolixanthone B, Parvifolixanthone B. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
1,5,6-trihydroxy-3-methoxy-4,7-bis(3-methylbut-2-enyl)xanthen-9-one (CAS 906794-57-8) is a chemical compound with the molecular formula C24H26O6 and a molecular weight of 410.5 g/mol. IUPAC name: 1,5,6-trihydroxy-3-methoxy-4,7-bis(3-methylbut-2-enyl)xanthen-9-one. InChIKey: RATPZJKZEAONEQ-UHFFFAOYSA-N.
| Molecular formula | C24H26O6 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 1,5,6-trihydroxy-3-methoxy-4,7-bis(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | RATPZJKZEAONEQ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC2=C(C(=C1O)O)OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC)O)C |
Computed by PubChem (NCBI)