CAS 19275-46-8 appears in our catalog under these names: 3-Isomangostin, 97%, 3–isomangostin, 3-Isomangostin/ 99.76% (existing batch purity), 3-Isomangostin 97%, 3-isomangostin, 97%, 97%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 20mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
5,9-dihydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydropyrano[3,2-b]xanthen-6-one (CAS 19275-46-8) is a chemical compound with the molecular formula C24H26O6 and a molecular weight of 410.5 g/mol. IUPAC name: 5,9-dihydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydropyrano[3,2-b]xanthen-6-one. InChIKey: KJCDBAVVDILRMP-UHFFFAOYSA-N.
| Molecular formula | C24H26O6 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 5,9-dihydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| InChIKey | KJCDBAVVDILRMP-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(C4=C(C=C3O2)OC(CC4)(C)C)O)O)OC)C |
Computed by PubChem (NCBI)