Products 155233-17-3
CAS 155233-17-3 appears in our catalog under these names: Caloxanthone B, Caloxanthone B. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
5,9-dihydroxy-10-methoxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one (CAS 155233-17-3) is a chemical compound with the molecular formula C24H26O6 and a molecular weight of 410.5 g/mol. IUPAC name: 5,9-dihydroxy-10-methoxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one. InChIKey: DNRJSJQWXWNVSH-UHFFFAOYSA-N.
| Molecular formula | C24H26O6 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 5,9-dihydroxy-10-methoxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one |
| InChIKey | DNRJSJQWXWNVSH-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(O1)C=C(C3=C2OC4=C(C3=O)C(=CC(=C4OC)O)CC=C(C)C)O)(C)C |
Computed by PubChem (NCBI)