cas: 74562-03-1 — see every product listed under this CAS number, including other names
Boc-(2-Thienyl)-Gly-OH 98% (CAS 74562-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A373029-100mg |
| cas | 74562-03-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 2228.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A373029 |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid (CAS 74562-03-1) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid. InChIKey: CFAJOXPICRIMCA-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thiophen-2-ylacetic acid |
| InChIKey | CFAJOXPICRIMCA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=CS1)C(=O)O |
Computed by PubChem (NCBI)