cas: 76387-70-7 — see every product listed under this CAS number, including other names
Boc-D-Dap-OH 97% (CAS 76387-70-7) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202801-1000g |
| cas | 76387-70-7 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 7262.31 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 971.12 Pln | |
| Ambeed | 500g | 4564.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202801 |
(2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 76387-70-7) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)