cas: 106719-44-2 — see every product listed under this CAS number, including other names
Boc-D-Lys-OH 97% (CAS 106719-44-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A176922-500g |
| cas | 106719-44-2 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 4152.88 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1093.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A176922 |
(2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 106719-44-2) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: DQUHYEDEGRNAFO-MRVPVSSYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | DQUHYEDEGRNAFO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)