Boc-D-N-Me-Phg-OH, 97%
cas: 30925-12-3 — see every product listed under this CAS number, including other names
Boc-D-N-Me-Phg-OH, 97% (CAS 30925-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1142NN-100mg |
| cas | 30925-12-3 |
| size | 100mg |
| availability | 175g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 10g | 1178.00 Pln | |
| Chemat | 25g | 2747.60 Pln | |
| Fluorochem | 1g | 180.16 Pln | |
| Fluorochem | 5g | 617.51 Pln | |
| Fluorochem | 10g | 1164.19 Pln | |
| Fluorochem | 25g | 2799.03 Pln | |
| Fluorochem | 100g | 10103.75 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid (CAS 30925-12-3) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid. InChIKey: COABPHLHHQAKPL-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid |
| InChIKey | COABPHLHHQAKPL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
boc-d-n-me-phg-oh, N-Boc-(R)-a-(MethylaMino)-benzeneacetic acid, (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid, n-boc-n-methyl-d-phenyl, n-boc-n-methyl-d-phenylglycine, (2R)-[(tert-Butoxycarbonyl)(methyl)amino](phenyl)acetic acid, (2R)-2-{[(tert-butoxy)carbonyl](methyl)amino}-2-phenylacetic acid, (R)-2-[Boc(methyl)amino]-2-phenylacetic Acid, N-Boc-(R)-alpha-(methylamino)benzeneacetic acid, (2R)-[(tert-butoxycarbonyl)(methyl)amino](phenyl)ethanoic acid