CAS 30925-08-7 appears in our catalog under these names: Boc-n-me-dl-phg-oh, 97%, 2-((tert-Butoxycarbonyl)(methyl)amino)-2-phenylacetic acid, 96%, Boc–N–Me–DL–Phg–OH, 2-((tert-Butoxycarbonyl)(methyl)amino)-2-phenylacetic acid, 98%, 98%, 2-((TERT-BUTOXYCARBONYL)(METHYL)AMINO)-2-PHENYLACETIC ACID, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 100mg.
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid (CAS 30925-08-7) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid. InChIKey: COABPHLHHQAKPL-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid |
| InChIKey | COABPHLHHQAKPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)