CAS 30925-11-2 appears in our catalog under these names: Boc–N–Me–Phg–OH, Boc-N-Me-Phg-OH 98%, Boc-N-Me-Phg-OH, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 5g, 250mg, 1g.
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid (CAS 30925-11-2) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid. InChIKey: COABPHLHHQAKPL-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid |
| InChIKey | COABPHLHHQAKPL-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)