CAS 30925-12-3 appears in our catalog under these names: Boc-d-n-me-phg-oh, 95%, Boc-D-N-Me-Phg-OH 95%, Boc-D-N-Me-Phg-OH, 95%, 95%, boc-d-n-me-phg-oh, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 100g.
(2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid (CAS 30925-12-3) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid. InChIKey: COABPHLHHQAKPL-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid |
| InChIKey | COABPHLHHQAKPL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)