cas: 57292-45-2 — see every product listed under this CAS number, including other names
Boc-D-Phe(4-F)-OH, 95%, 95% (CAS 57292-45-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OG7-250mg |
| cas | 57292-45-2 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 534.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 57292-45-2) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-LLVKDONJSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)