cas: 141527-78-8 — see every product listed under this CAS number, including other names
Boc-D-Ser-OBzl 95% (CAS 141527-78-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151528-250mg |
| cas | 141527-78-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 609.56 Pln | |
| Ambeed | 500g | 2762.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151528 |
Benzyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 141527-78-8) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: benzyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: BQADRZHPZVQGCW-GFCCVEGCSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | benzyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | BQADRZHPZVQGCW-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)